C22H15NO3 — CID 11336777
2-[(2-benzoylphenyl)methyl]isoindole-1,3-dione (PubChem CID 11336777) has the molecular formula C22H15NO3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-[(2-benzoylphenyl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(2-benzoylphenyl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11336777 |
| Molecular Formula | C22H15NO3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 2-[(2-benzoylphenyl)methyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccccc1)c1ccccc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H15NO3/c24-20(15-8-2-1-3-9-15)17-11-5-4-10-16(17)14-23-21(25)18-12-6-7-13-19(18)22(23)26/h1-13H,14H2 |
| InChIKey | CLNNCVILFVGFBY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|