C25H18N4O3 — CID 21496129
2-[[4-(2-benzoylphenyl)-5-methyl-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione (PubChem CID 21496129) has the molecular formula C25H18N4O3 and a molecular weight of 422.44 g/mol. Its IUPAC name is 2-[[4-(2-benzoylphenyl)-5-methyl-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-(2-benzoylphenyl)-5-methyl-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21496129 |
| Molecular Formula | C25H18N4O3 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-[[4-(2-benzoylphenyl)-5-methyl-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione |
| SMILES | Cc1nnc(CN2C(=O)c3ccccc3C2=O)n1-c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H18N4O3/c1-16-26-27-22(15-28-24(31)18-11-5-6-12-19(18)25(28)32)29(16)21-14-8-7-13-20(21)23(30)17-9-3-2-4-10-17/h2-14H,15H2,1H3 |
| InChIKey | QXCYYXZYIAHVTL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|