C28H23ClN6O5 — CID 21494754
2-[[4-[2-(3-chlorobenzoyl)-4-nitrophenyl]-5-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione (PubChem CID 21494754) has the molecular formula C28H23ClN6O5 and a molecular weight of 558.98 g/mol. Its IUPAC name is 2-[[4-[2-(3-chlorobenzoyl)-4-nitrophenyl]-5-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[2-(3-chlorobenzoyl)-4-nitrophenyl]-5-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21494754 |
| Molecular Formula | C28H23ClN6O5 |
| Molecular Weight | 558.98 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 2-[[4-[2-(3-chlorobenzoyl)-4-nitrophenyl]-5-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione |
| SMILES | CN(C)CCc1nnc(CN2C(=O)c3ccccc3C2=O)n1-c1ccc([N+](=O)[O-])cc1C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C28H23ClN6O5/c1-32(2)13-12-24-30-31-25(16-33-27(37)20-8-3-4-9-21(20)28(33)38)34(24)23-11-10-19(35(39)40)15-22(23)26(36)17-6-5-7-18(29)14-17/h3-11,14-15H,12-13,16H2,1-2H3 |
| InChIKey | IHBWDYDTJDVKFR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 131.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.98 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|