C24H14ClFN4O3 — CID 21498891
2-[[4-(2-benzoyl-4-fluorophenyl)-5-chloro-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione (PubChem CID 21498891) has the molecular formula C24H14ClFN4O3 and a molecular weight of 460.85 g/mol. Its IUPAC name is 2-[[4-(2-benzoyl-4-fluorophenyl)-5-chloro-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-(2-benzoyl-4-fluorophenyl)-5-chloro-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21498891 |
| Molecular Formula | C24H14ClFN4O3 |
| Molecular Weight | 460.85 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 2-[[4-(2-benzoyl-4-fluorophenyl)-5-chloro-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccccc1)c1cc(F)ccc1-n1c(Cl)nnc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H14ClFN4O3/c25-24-28-27-20(13-29-22(32)16-8-4-5-9-17(16)23(29)33)30(24)19-11-10-15(26)12-18(19)21(31)14-6-2-1-3-7-14/h1-12H,13H2 |
| InChIKey | IAMVDVRTJZRJKX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.85 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|