C27H20ClN5O4 — CID 163973088
1-(2-benzoyl-4-chlorophenyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]-N,N-dimethyl-1,2,4-triazole-3-carboxamide (PubChem CID 163973088) has the molecular formula C27H20ClN5O4 and a molecular weight of 513.94 g/mol. Its IUPAC name is 1-(2-benzoyl-4-chlorophenyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]-N,N-dimethyl-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(2-benzoyl-4-chlorophenyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]-N,N-dimethyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 163973088 |
| Molecular Formula | C27H20ClN5O4 |
| Molecular Weight | 513.94 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 1-(2-benzoyl-4-chlorophenyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]-N,N-dimethyl-1,2,4-triazole-3-carboxamide |
| SMILES | CN(C)C(=O)c1nc(CN2C(=O)c3ccccc3C2=O)n(-c2ccc(Cl)cc2C(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C27H20ClN5O4/c1-31(2)27(37)24-29-22(15-32-25(35)18-10-6-7-11-19(18)26(32)36)33(30-24)21-13-12-17(28)14-20(21)23(34)16-8-4-3-5-9-16/h3-14H,15H2,1-2H3 |
| InChIKey | SRSPVLIRMDFZHK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 105.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.94 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|