C24H13BrCl2N4O3 — CID 21498895
2-[[5-bromo-4-[4-chloro-2-(2-chlorobenzoyl)phenyl]-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione (PubChem CID 21498895) has the molecular formula C24H13BrCl2N4O3 and a molecular weight of 556.20 g/mol. Its IUPAC name is 2-[[5-bromo-4-[4-chloro-2-(2-chlorobenzoyl)phenyl]-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-bromo-4-[4-chloro-2-(2-chlorobenzoyl)phenyl]-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21498895 |
| Molecular Formula | C24H13BrCl2N4O3 |
| Molecular Weight | 556.20 g/mol |
| Exact Mass | 553.95 |
| IUPAC Name | 2-[[5-bromo-4-[4-chloro-2-(2-chlorobenzoyl)phenyl]-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccccc1Cl)c1cc(Cl)ccc1-n1c(Br)nnc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H13BrCl2N4O3/c25-24-29-28-20(12-30-22(33)14-5-1-2-6-15(14)23(30)34)31(24)19-10-9-13(26)11-17(19)21(32)16-7-3-4-8-18(16)27/h1-11H,12H2 |
| InChIKey | FKYDWWMXMUNGNI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.20 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|