C17H12Cl2IN3O — CID 21488662
[5-chloro-2-[3-(iodomethyl)-5-methyl-1,2,4-triazol-4-yl]phenyl]-(2-chlorophenyl)methanone (PubChem CID 21488662) has the molecular formula C17H12Cl2IN3O and a molecular weight of 472.11 g/mol. Its IUPAC name is [5-chloro-2-[3-(iodomethyl)-5-methyl-1,2,4-triazol-4-yl]phenyl]-(2-chlorophenyl)methanone.
| Compound Name | [5-chloro-2-[3-(iodomethyl)-5-methyl-1,2,4-triazol-4-yl]phenyl]-(2-chlorophenyl)methanone |
|---|---|
| PubChem CID | 21488662 |
| Molecular Formula | C17H12Cl2IN3O |
| Molecular Weight | 472.11 g/mol |
| Exact Mass | 470.94 |
| IUPAC Name | [5-chloro-2-[3-(iodomethyl)-5-methyl-1,2,4-triazol-4-yl]phenyl]-(2-chlorophenyl)methanone |
| SMILES | Cc1nnc(CI)n1-c1ccc(Cl)cc1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H12Cl2IN3O/c1-10-21-22-16(9-20)23(10)15-7-6-11(18)8-13(15)17(24)12-4-2-3-5-14(12)19/h2-8H,9H2,1H3 |
| InChIKey | NYESMEKBYYZHTG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.11 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|