C25H19Cl3N4O3 — CID 15573091
benzyl N-[[4-[4-chloro-2-(2-chlorobenzoyl)phenyl]-5-(chloromethyl)-1,2,4-triazol-3-yl]methyl]carbamate (PubChem CID 15573091) has the molecular formula C25H19Cl3N4O3 and a molecular weight of 529.81 g/mol. Its IUPAC name is benzyl N-[[4-[4-chloro-2-(2-chlorobenzoyl)phenyl]-5-(chloromethyl)-1,2,4-triazol-3-yl]methyl]carbamate.
| Compound Name | benzyl N-[[4-[4-chloro-2-(2-chlorobenzoyl)phenyl]-5-(chloromethyl)-1,2,4-triazol-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 15573091 |
| Molecular Formula | C25H19Cl3N4O3 |
| Molecular Weight | 529.81 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | benzyl N-[[4-[4-chloro-2-(2-chlorobenzoyl)phenyl]-5-(chloromethyl)-1,2,4-triazol-3-yl]methyl]carbamate |
| SMILES | O=C(NCc1nnc(CCl)n1-c1ccc(Cl)cc1C(=O)c1ccccc1Cl)OCc1ccccc1 |
| InChI | InChI=1S/C25H19Cl3N4O3/c26-13-22-30-31-23(14-29-25(34)35-15-16-6-2-1-3-7-16)32(22)21-11-10-17(27)12-19(21)24(33)18-8-4-5-9-20(18)28/h1-12H,13-15H2,(H,29,34) |
| InChIKey | YDMXANPUHJXHRR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.81 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|