C17H15Cl2NO5 — CID 68945478
(2S)-2-(2,5-dichlorophenoxy)-3-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 68945478) has the molecular formula C17H15Cl2NO5 and a molecular weight of 384.22 g/mol. Its IUPAC name is (2S)-2-(2,5-dichlorophenoxy)-3-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-2-(2,5-dichlorophenoxy)-3-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 68945478 |
| Molecular Formula | C17H15Cl2NO5 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | (2S)-2-(2,5-dichlorophenoxy)-3-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(NC[C@H](Oc1cc(Cl)ccc1Cl)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C17H15Cl2NO5/c18-12-6-7-13(19)14(8-12)25-15(16(21)22)9-20-17(23)24-10-11-4-2-1-3-5-11/h1-8,15H,9-10H2,(H,20,23)(H,21,22)/t15-/m0/s1 |
| InChIKey | JGWSQGQMQISLOL-HNNXBMFYSA-N |
| XLogP | 3.75 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |