C17H16ClF2NO4 — CID 171855742
benzyl N-[3-(3-chloro-2,4-difluorophenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171855742) has the molecular formula C17H16ClF2NO4 and a molecular weight of 371.77 g/mol. Its IUPAC name is benzyl N-[3-(3-chloro-2,4-difluorophenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(3-chloro-2,4-difluorophenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855742 |
| Molecular Formula | C17H16ClF2NO4 |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | benzyl N-[3-(3-chloro-2,4-difluorophenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1ccc(F)c(Cl)c1F)OCc1ccccc1 |
| InChI | InChI=1S/C17H16ClF2NO4/c18-14-12(19)7-6-11(15(14)20)16(23)13(22)8-21-17(24)25-9-10-4-2-1-3-5-10/h1-7,13,16,22-23H,8-9H2,(H,21,24) |
| InChIKey | MBONSGKRWJXRBZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|