C17H18FNO5 — CID 171857228
benzyl N-[3-(2-fluoro-4-hydroxyphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171857228) has the molecular formula C17H18FNO5 and a molecular weight of 335.33 g/mol. Its IUPAC name is benzyl N-[3-(2-fluoro-4-hydroxyphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(2-fluoro-4-hydroxyphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171857228 |
| Molecular Formula | C17H18FNO5 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | benzyl N-[3-(2-fluoro-4-hydroxyphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1ccc(O)cc1F)OCc1ccccc1 |
| InChI | InChI=1S/C17H18FNO5/c18-14-8-12(20)6-7-13(14)16(22)15(21)9-19-17(23)24-10-11-4-2-1-3-5-11/h1-8,15-16,20-22H,9-10H2,(H,19,23) |
| InChIKey | CZVDDODAAISSQP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |