C18H20N2O6 — CID 171856383
3-amino-4-[1,2-dihydroxy-3-(phenylmethoxycarbonylamino)propyl]benzoic acid (PubChem CID 171856383) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is 3-amino-4-[1,2-dihydroxy-3-(phenylmethoxycarbonylamino)propyl]benzoic acid.
| Compound Name | 3-amino-4-[1,2-dihydroxy-3-(phenylmethoxycarbonylamino)propyl]benzoic acid |
|---|---|
| PubChem CID | 171856383 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-amino-4-[1,2-dihydroxy-3-(phenylmethoxycarbonylamino)propyl]benzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1C(O)C(O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H20N2O6/c19-14-8-12(17(23)24)6-7-13(14)16(22)15(21)9-20-18(25)26-10-11-4-2-1-3-5-11/h1-8,15-16,21-22H,9-10,19H2,(H,20,25)(H,23,24) |
| InChIKey | IOMGEPVWKYRQIE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|