C19H24N2O4 — CID 171855969
benzyl N-[3-(2-amino-5-ethylphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171855969) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is benzyl N-[3-(2-amino-5-ethylphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(2-amino-5-ethylphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855969 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | benzyl N-[3-(2-amino-5-ethylphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CCc1ccc(N)c(C(O)C(O)CNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H24N2O4/c1-2-13-8-9-16(20)15(10-13)18(23)17(22)11-21-19(24)25-12-14-6-4-3-5-7-14/h3-10,17-18,22-23H,2,11-12,20H2,1H3,(H,21,24) |
| InChIKey | OVSDLTMKNHNCFF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|