C17H21NO5 — CID 171857346
benzyl N-[3-(5-ethylfuran-2-yl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171857346) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is benzyl N-[3-(5-ethylfuran-2-yl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(5-ethylfuran-2-yl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171857346 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | benzyl N-[3-(5-ethylfuran-2-yl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CCc1ccc(C(O)C(O)CNC(=O)OCc2ccccc2)o1 |
| InChI | InChI=1S/C17H21NO5/c1-2-13-8-9-15(23-13)16(20)14(19)10-18-17(21)22-11-12-6-4-3-5-7-12/h3-9,14,16,19-20H,2,10-11H2,1H3,(H,18,21) |
| InChIKey | JABFTVPIOUJMQH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |