C25H20Cl2N4O3S — CID 15573093
benzyl N-[[4-[4-chloro-2-(2-chlorobenzoyl)phenyl]-5-(sulfanylmethyl)-1,2,4-triazol-3-yl]methyl]carbamate (PubChem CID 15573093) has the molecular formula C25H20Cl2N4O3S and a molecular weight of 527.43 g/mol. Its IUPAC name is benzyl N-[[4-[4-chloro-2-(2-chlorobenzoyl)phenyl]-5-(sulfanylmethyl)-1,2,4-triazol-3-yl]methyl]carbamate.
| Compound Name | benzyl N-[[4-[4-chloro-2-(2-chlorobenzoyl)phenyl]-5-(sulfanylmethyl)-1,2,4-triazol-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 15573093 |
| Molecular Formula | C25H20Cl2N4O3S |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | benzyl N-[[4-[4-chloro-2-(2-chlorobenzoyl)phenyl]-5-(sulfanylmethyl)-1,2,4-triazol-3-yl]methyl]carbamate |
| SMILES | O=C(NCc1nnc(CS)n1-c1ccc(Cl)cc1C(=O)c1ccccc1Cl)OCc1ccccc1 |
| InChI | InChI=1S/C25H20Cl2N4O3S/c26-17-10-11-21(19(12-17)24(32)18-8-4-5-9-20(18)27)31-22(29-30-23(31)15-35)13-28-25(33)34-14-16-6-2-1-3-7-16/h1-12,35H,13-15H2,(H,28,33) |
| InChIKey | UVVKNOBBPPQJLZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|