C22H21ClN6O3 — CID 21450903
(2-chlorophenyl)-[2-[3-[(dimethylamino)methyl]-5-[(prop-2-ynylamino)methyl]-1,2,4-triazol-4-yl]-5-nitrophenyl]methanone (PubChem CID 21450903) has the molecular formula C22H21ClN6O3 and a molecular weight of 452.90 g/mol. Its IUPAC name is (2-chlorophenyl)-[2-[3-[(dimethylamino)methyl]-5-[(prop-2-ynylamino)methyl]-1,2,4-triazol-4-yl]-5-nitrophenyl]methanone.
| Compound Name | (2-chlorophenyl)-[2-[3-[(dimethylamino)methyl]-5-[(prop-2-ynylamino)methyl]-1,2,4-triazol-4-yl]-5-nitrophenyl]methanone |
|---|---|
| PubChem CID | 21450903 |
| Molecular Formula | C22H21ClN6O3 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (2-chlorophenyl)-[2-[3-[(dimethylamino)methyl]-5-[(prop-2-ynylamino)methyl]-1,2,4-triazol-4-yl]-5-nitrophenyl]methanone |
| SMILES | C#CCNCc1nnc(CN(C)C)n1-c1ccc([N+](=O)[O-])cc1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H21ClN6O3/c1-4-11-24-13-20-25-26-21(14-27(2)3)28(20)19-10-9-15(29(31)32)12-17(19)22(30)16-7-5-6-8-18(16)23/h1,5-10,12,24H,11,13-14H2,2-3H3 |
| InChIKey | PZTLFTDYYGJOAG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|