C21H22ClN5O4 — CID 21450960
(2-chlorophenyl)-[2-[3-[1-(dimethylamino)propyl]-5-(hydroxymethyl)-1,2,4-triazol-4-yl]-5-nitrophenyl]methanone (PubChem CID 21450960) has the molecular formula C21H22ClN5O4 and a molecular weight of 443.89 g/mol. Its IUPAC name is (2-chlorophenyl)-[2-[3-[1-(dimethylamino)propyl]-5-(hydroxymethyl)-1,2,4-triazol-4-yl]-5-nitrophenyl]methanone.
| Compound Name | (2-chlorophenyl)-[2-[3-[1-(dimethylamino)propyl]-5-(hydroxymethyl)-1,2,4-triazol-4-yl]-5-nitrophenyl]methanone |
|---|---|
| PubChem CID | 21450960 |
| Molecular Formula | C21H22ClN5O4 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (2-chlorophenyl)-[2-[3-[1-(dimethylamino)propyl]-5-(hydroxymethyl)-1,2,4-triazol-4-yl]-5-nitrophenyl]methanone |
| SMILES | CCC(c1nnc(CO)n1-c1ccc([N+](=O)[O-])cc1C(=O)c1ccccc1Cl)N(C)C |
| InChI | InChI=1S/C21H22ClN5O4/c1-4-17(25(2)3)21-24-23-19(12-28)26(21)18-10-9-13(27(30)31)11-15(18)20(29)14-7-5-6-8-16(14)22/h5-11,17,28H,4,12H2,1-3H3 |
| InChIKey | LUIDHPDSHXARPC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|