C21H14N2O3S — CID 23249584
2-[(3-benzoyl-2-sulfanylidene-1H-pyridin-4-yl)methyl]isoindole-1,3-dione (PubChem CID 23249584) has the molecular formula C21H14N2O3S and a molecular weight of 374.42 g/mol. Its IUPAC name is 2-[(3-benzoyl-2-sulfanylidene-1H-pyridin-4-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(3-benzoyl-2-sulfanylidene-1H-pyridin-4-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23249584 |
| Molecular Formula | C21H14N2O3S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-[(3-benzoyl-2-sulfanylidene-1H-pyridin-4-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccccc1)c1c(CN2C(=O)c3ccccc3C2=O)cc[nH]c1=S |
| InChI | InChI=1S/C21H14N2O3S/c24-18(13-6-2-1-3-7-13)17-14(10-11-22-19(17)27)12-23-20(25)15-8-4-5-9-16(15)21(23)26/h1-11H,12H2,(H,22,27) |
| InChIKey | FJYMPBQMGNQVTL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|