C15H11N2O4+ — CID 178053204
6-[(1,3-dioxoisoindol-2-yl)methyl]pyridin-1-ium-2-carboxylic acid (PubChem CID 178053204) has the molecular formula C15H11N2O4+ and a molecular weight of 283.26 g/mol. Its IUPAC name is 6-[(1,3-dioxoisoindol-2-yl)methyl]pyridin-1-ium-2-carboxylic acid.
| Compound Name | 6-[(1,3-dioxoisoindol-2-yl)methyl]pyridin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 178053204 |
| Molecular Formula | C15H11N2O4+ |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 6-[(1,3-dioxoisoindol-2-yl)methyl]pyridin-1-ium-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(CN2C(=O)c3ccccc3C2=O)[nH+]1 |
| InChI | InChI=1S/C15H10N2O4/c18-13-10-5-1-2-6-11(10)14(19)17(13)8-9-4-3-7-12(16-9)15(20)21/h1-7H,8H2,(H,20,21)/p+1 |
| InChIKey | BVQSPZKAMPPAQC-UHFFFAOYSA-O |
| XLogP | 1.00 |
| TPSA | 88.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|