C15H10N2O4 — CID 114324415
2-[(1,3-dioxoisoindol-2-yl)methyl]pyridine-4-carboxylic acid (PubChem CID 114324415) has the molecular formula C15H10N2O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-2-yl)methyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114324415 |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C15H10N2O4/c18-13-11-3-1-2-4-12(11)14(19)17(13)8-10-7-9(15(20)21)5-6-16-10/h1-7H,8H2,(H,20,21) |
| InChIKey | TTYBRQVPGDGEOZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|