C25H27N3O2 — CID 89474862
2-[(4-benzhydryl-1,4-diazepan-1-yl)methyl]pyridine-4-carboxylic acid (PubChem CID 89474862) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-[(4-benzhydryl-1,4-diazepan-1-yl)methyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[(4-benzhydryl-1,4-diazepan-1-yl)methyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 89474862 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 2-[(4-benzhydryl-1,4-diazepan-1-yl)methyl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(CN2CCCN(C(c3ccccc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C25H27N3O2/c29-25(30)22-12-13-26-23(18-22)19-27-14-7-15-28(17-16-27)24(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-13,18,24H,7,14-17,19H2,(H,29,30) |
| InChIKey | TXMMLSDLUOPIBB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |