C26H28FN3O2 — CID 89474547
ethyl 2-[[4-[(3-fluorophenyl)-phenylmethyl]piperazin-1-yl]methyl]pyridine-4-carboxylate (PubChem CID 89474547) has the molecular formula C26H28FN3O2 and a molecular weight of 433.53 g/mol. Its IUPAC name is ethyl 2-[[4-[(3-fluorophenyl)-phenylmethyl]piperazin-1-yl]methyl]pyridine-4-carboxylate.
| Compound Name | ethyl 2-[[4-[(3-fluorophenyl)-phenylmethyl]piperazin-1-yl]methyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 89474547 |
| Molecular Formula | C26H28FN3O2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | ethyl 2-[[4-[(3-fluorophenyl)-phenylmethyl]piperazin-1-yl]methyl]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(CN2CCN(C(c3ccccc3)c3cccc(F)c3)CC2)c1 |
| InChI | InChI=1S/C26H28FN3O2/c1-2-32-26(31)22-11-12-28-24(18-22)19-29-13-15-30(16-14-29)25(20-7-4-3-5-8-20)21-9-6-10-23(27)17-21/h3-12,17-18,25H,2,13-16,19H2,1H3 |
| InChIKey | ROJKARRTSFJECY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |