C11H10N2O2 — CID 114324425
2-(pyrrol-1-ylmethyl)pyridine-4-carboxylic acid (PubChem CID 114324425) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-(pyrrol-1-ylmethyl)pyridine-4-carboxylic acid.
| Compound Name | 2-(pyrrol-1-ylmethyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114324425 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-(pyrrol-1-ylmethyl)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(Cn2cccc2)c1 |
| InChI | InChI=1S/C11H10N2O2/c14-11(15)9-3-4-12-10(7-9)8-13-5-1-2-6-13/h1-7H,8H2,(H,14,15) |
| InChIKey | BAZPLYLCONXNLV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |