C11H15NO5 — CID 68836420
2-(2,2,2-trimethoxyethyl)pyridine-4-carboxylic acid (PubChem CID 68836420) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is 2-(2,2,2-trimethoxyethyl)pyridine-4-carboxylic acid.
| Compound Name | 2-(2,2,2-trimethoxyethyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 68836420 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-(2,2,2-trimethoxyethyl)pyridine-4-carboxylic acid |
| SMILES | COC(Cc1cc(C(=O)O)ccn1)(OC)OC |
| InChI | InChI=1S/C11H15NO5/c1-15-11(16-2,17-3)7-9-6-8(10(13)14)4-5-12-9/h4-6H,7H2,1-3H3,(H,13,14) |
| InChIKey | FRFDVGXQUMKUHI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|