C11H15NO3 — CID 91151516
2-(2,2-dimethylpropoxy)pyridine-4-carboxylic acid (PubChem CID 91151516) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-(2,2-dimethylpropoxy)pyridine-4-carboxylic acid.
| Compound Name | 2-(2,2-dimethylpropoxy)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 91151516 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-(2,2-dimethylpropoxy)pyridine-4-carboxylic acid |
| SMILES | CC(C)(C)COc1cc(C(=O)O)ccn1 |
| InChI | InChI=1S/C11H15NO3/c1-11(2,3)7-15-9-6-8(10(13)14)4-5-12-9/h4-6H,7H2,1-3H3,(H,13,14) |
| InChIKey | IIKKSVOFDCJGAX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |