C14H20N2O6 — CID 120531677
3-methoxy-2-[[2-(2-methoxyethoxy)pyridine-4-carbonyl]amino]-2-methylpropanoic acid (PubChem CID 120531677) has the molecular formula C14H20N2O6 and a molecular weight of 312.32 g/mol. Its IUPAC name is 3-methoxy-2-[[2-(2-methoxyethoxy)pyridine-4-carbonyl]amino]-2-methylpropanoic acid.
| Compound Name | 3-methoxy-2-[[2-(2-methoxyethoxy)pyridine-4-carbonyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120531677 |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 3-methoxy-2-[[2-(2-methoxyethoxy)pyridine-4-carbonyl]amino]-2-methylpropanoic acid |
| SMILES | COCCOc1cc(C(=O)NC(C)(COC)C(=O)O)ccn1 |
| InChI | InChI=1S/C14H20N2O6/c1-14(9-21-3,13(18)19)16-12(17)10-4-5-15-11(8-10)22-7-6-20-2/h4-5,8H,6-7,9H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | PAXVWZWSJJIIIN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|