C13H14N4O3 — CID 119100115
2-(2-methoxyethoxy)-N-pyrimidin-2-ylpyridine-4-carboxamide (PubChem CID 119100115) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-pyrimidin-2-ylpyridine-4-carboxamide.
| Compound Name | 2-(2-methoxyethoxy)-N-pyrimidin-2-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 119100115 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-pyrimidin-2-ylpyridine-4-carboxamide |
| SMILES | COCCOc1cc(C(=O)Nc2ncccn2)ccn1 |
| InChI | InChI=1S/C13H14N4O3/c1-19-7-8-20-11-9-10(3-6-14-11)12(18)17-13-15-4-2-5-16-13/h2-6,9H,7-8H2,1H3,(H,15,16,17,18) |
| InChIKey | AZRYBSHWAQUZKI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|