C14H18N2O5 — CID 121017369
methyl 1-[2-(2-methoxyethoxy)pyridine-4-carbonyl]azetidine-3-carboxylate (PubChem CID 121017369) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is methyl 1-[2-(2-methoxyethoxy)pyridine-4-carbonyl]azetidine-3-carboxylate.
| Compound Name | methyl 1-[2-(2-methoxyethoxy)pyridine-4-carbonyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 121017369 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | methyl 1-[2-(2-methoxyethoxy)pyridine-4-carbonyl]azetidine-3-carboxylate |
| SMILES | COCCOc1cc(C(=O)N2CC(C(=O)OC)C2)ccn1 |
| InChI | InChI=1S/C14H18N2O5/c1-19-5-6-21-12-7-10(3-4-15-12)13(17)16-8-11(9-16)14(18)20-2/h3-4,7,11H,5-6,8-9H2,1-2H3 |
| InChIKey | FSVQRIZYCUURPO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|