C19H29N3O5 — CID 124891577
tert-butyl (3S)-4-[2-(2-methoxyethoxy)pyridine-4-carbonyl]-3-methylpiperazine-1-carboxylate (PubChem CID 124891577) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is tert-butyl (3S)-4-[2-(2-methoxyethoxy)pyridine-4-carbonyl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-[2-(2-methoxyethoxy)pyridine-4-carbonyl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 124891577 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | tert-butyl (3S)-4-[2-(2-methoxyethoxy)pyridine-4-carbonyl]-3-methylpiperazine-1-carboxylate |
| SMILES | COCCOc1cc(C(=O)N2CCN(C(=O)OC(C)(C)C)C[C@@H]2C)ccn1 |
| InChI | InChI=1S/C19H29N3O5/c1-14-13-21(18(24)27-19(2,3)4)8-9-22(14)17(23)15-6-7-20-16(12-15)26-11-10-25-5/h6-7,12,14H,8-11,13H2,1-5H3/t14-/m0/s1 |
| InChIKey | DIDKHDGWJXCKKO-AWEZNQCLSA-N |
| XLogP | 2.19 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|