C17H22Cl2N2O3 — CID 95777639
tert-butyl (2R)-4-(3,4-dichlorobenzoyl)-2-methylpiperazine-1-carboxylate (PubChem CID 95777639) has the molecular formula C17H22Cl2N2O3 and a molecular weight of 373.28 g/mol. Its IUPAC name is tert-butyl (2R)-4-(3,4-dichlorobenzoyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-(3,4-dichlorobenzoyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 95777639 |
| Molecular Formula | C17H22Cl2N2O3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | tert-butyl (2R)-4-(3,4-dichlorobenzoyl)-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(Cl)c(Cl)c2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22Cl2N2O3/c1-11-10-20(7-8-21(11)16(23)24-17(2,3)4)15(22)12-5-6-13(18)14(19)9-12/h5-6,9,11H,7-8,10H2,1-4H3/t11-/m1/s1 |
| InChIKey | LSKIHUSWBHTFNI-LLVKDONJSA-N |
| XLogP | 4.07 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |