C18H22BrF3N2O3 — CID 176508171
tert-butyl 4-[3-bromo-4-(trifluoromethyl)benzoyl]-2-methylpiperazine-1-carboxylate (PubChem CID 176508171) has the molecular formula C18H22BrF3N2O3 and a molecular weight of 451.28 g/mol. Its IUPAC name is tert-butyl 4-[3-bromo-4-(trifluoromethyl)benzoyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-bromo-4-(trifluoromethyl)benzoyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 176508171 |
| Molecular Formula | C18H22BrF3N2O3 |
| Molecular Weight | 451.28 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | tert-butyl 4-[3-bromo-4-(trifluoromethyl)benzoyl]-2-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)c2ccc(C(F)(F)F)c(Br)c2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H22BrF3N2O3/c1-11-10-23(7-8-24(11)16(26)27-17(2,3)4)15(25)12-5-6-13(14(19)9-12)18(20,21)22/h5-6,9,11H,7-8,10H2,1-4H3 |
| InChIKey | BEGKFLZJHBVFOP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |