C17H21BrF2N2O3 — CID 168511291
tert-butyl (2S)-4-(4-bromo-2,3-difluorobenzoyl)-2-methylpiperazine-1-carboxylate (PubChem CID 168511291) has the molecular formula C17H21BrF2N2O3 and a molecular weight of 419.27 g/mol. Its IUPAC name is tert-butyl (2S)-4-(4-bromo-2,3-difluorobenzoyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-(4-bromo-2,3-difluorobenzoyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 168511291 |
| Molecular Formula | C17H21BrF2N2O3 |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | tert-butyl (2S)-4-(4-bromo-2,3-difluorobenzoyl)-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)c2ccc(Br)c(F)c2F)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H21BrF2N2O3/c1-10-9-21(7-8-22(10)16(24)25-17(2,3)4)15(23)11-5-6-12(18)14(20)13(11)19/h5-6,10H,7-9H2,1-4H3/t10-/m0/s1 |
| InChIKey | YPEZUNCLJWKHKZ-JTQLQIEISA-N |
| XLogP | 3.81 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|