C18H24BrFN2O3 — CID 176513331
tert-butyl (2R)-4-(3-bromo-5-fluoro-4-methylbenzoyl)-2-methylpiperazine-1-carboxylate (PubChem CID 176513331) has the molecular formula C18H24BrFN2O3 and a molecular weight of 415.30 g/mol. Its IUPAC name is tert-butyl (2R)-4-(3-bromo-5-fluoro-4-methylbenzoyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-(3-bromo-5-fluoro-4-methylbenzoyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 176513331 |
| Molecular Formula | C18H24BrFN2O3 |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | tert-butyl (2R)-4-(3-bromo-5-fluoro-4-methylbenzoyl)-2-methylpiperazine-1-carboxylate |
| SMILES | Cc1c(F)cc(C(=O)N2CCN(C(=O)OC(C)(C)C)[C@H](C)C2)cc1Br |
| InChI | InChI=1S/C18H24BrFN2O3/c1-11-10-21(6-7-22(11)17(24)25-18(3,4)5)16(23)13-8-14(19)12(2)15(20)9-13/h8-9,11H,6-7,10H2,1-5H3/t11-/m1/s1 |
| InChIKey | VEEUWPGKKHKLCB-LLVKDONJSA-N |
| XLogP | 3.98 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |