C11H13N3O3 — CID 114324863
2-[(2-oxo-1,3-diazinan-1-yl)methyl]pyridine-4-carboxylic acid (PubChem CID 114324863) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-[(2-oxo-1,3-diazinan-1-yl)methyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[(2-oxo-1,3-diazinan-1-yl)methyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114324863 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-[(2-oxo-1,3-diazinan-1-yl)methyl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(CN2CCCNC2=O)c1 |
| InChI | InChI=1S/C11H13N3O3/c15-10(16)8-2-4-12-9(6-8)7-14-5-1-3-13-11(14)17/h2,4,6H,1,3,5,7H2,(H,13,17)(H,15,16) |
| InChIKey | BYGOQVRBCBMEAX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |