C11H14N2O4S — CID 116814508
2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid (PubChem CID 116814508) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 116814508 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(CN2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C11H14N2O4S/c14-11(15)9-3-4-12-10(7-9)8-13-5-1-2-6-18(13,16)17/h3-4,7H,1-2,5-6,8H2,(H,14,15) |
| InChIKey | ZAPPDNQMECMJCS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |