2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid

C11H14N2O4S — CID 116814508

IUPAC2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid
SMILESO=C(O)c1ccnc(CN2CCCCS2(=O)=O)c1
InChIInChI=1S/C11H14N2O4S/c14-11(15)9-3-4-12-10(7-9)8-13-5-1-2-6-18(13,16)17/h3-4,7H,1-2,5-6,8H2,(H,14,15)
InChIKeyZAPPDNQMECMJCS-UHFFFAOYSA-N
MW270.31 g/mol
LogP0.71
Rot. Bonds3

About 2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid

2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid (PubChem CID 116814508) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid.

Molecular Properties

Compound Name2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid
PubChem CID116814508
Molecular FormulaC11H14N2O4S
Molecular Weight270.31 g/mol
Exact Mass270.07
IUPAC Name2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid
SMILESO=C(O)c1ccnc(CN2CCCCS2(=O)=O)c1
InChIInChI=1S/C11H14N2O4S/c14-11(15)9-3-4-12-10(7-9)8-13-5-1-2-6-18(13,16)17/h3-4,7H,1-2,5-6,8H2,(H,14,15)
InChIKeyZAPPDNQMECMJCS-UHFFFAOYSA-N
XLogP0.71
TPSA87.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.31
LogP ≤ 50.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid?
The IUPAC name of 2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid (CID 116814508) is 2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid.
What is the SMILES notation for 2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid?
The canonical SMILES for 2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid is O=C(O)c1ccnc(CN2CCCCS2(=O)=O)c1.
What is the InChIKey of 2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid?
The InChIKey is ZAPPDNQMECMJCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O4S/c14-11(15)9-3-4-12-10(7-9)8-13-5-1-2-6-18(13,16)17/h3-4,7H,1-2,5-6,8H2,(H,14,15).
What are the key properties of 2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid?
2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid has a molecular weight of 270.31 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxothiazinan-2-yl)methyl]pyridine-4-carboxylic acid is sourced from PubChem (CID 116814508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).