C11H11N3O4S — CID 114324081
2-[[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]methyl]pyridine-4-carboxylic acid (PubChem CID 114324081) has the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. Its IUPAC name is 2-[[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]methyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]methyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114324081 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-[[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]methyl]pyridine-4-carboxylic acid |
| SMILES | O=C1NC(C(=O)NCc2cc(C(=O)O)ccn2)CS1 |
| InChI | InChI=1S/C11H11N3O4S/c15-9(8-5-19-11(18)14-8)13-4-7-3-6(10(16)17)1-2-12-7/h1-3,8H,4-5H2,(H,13,15)(H,14,18)(H,16,17) |
| InChIKey | ADYXUUZWRJFLDI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|