C12H15N3O3S — CID 103064162
2-[(thiolan-3-ylcarbamoylamino)methyl]pyridine-4-carboxylic acid (PubChem CID 103064162) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-[(thiolan-3-ylcarbamoylamino)methyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[(thiolan-3-ylcarbamoylamino)methyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 103064162 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-[(thiolan-3-ylcarbamoylamino)methyl]pyridine-4-carboxylic acid |
| SMILES | O=C(NCc1cc(C(=O)O)ccn1)NC1CCSC1 |
| InChI | InChI=1S/C12H15N3O3S/c16-11(17)8-1-3-13-10(5-8)6-14-12(18)15-9-2-4-19-7-9/h1,3,5,9H,2,4,6-7H2,(H,16,17)(H2,14,15,18) |
| InChIKey | YZEHBHNRAPIONY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |