C25H23NO4 — CID 178053111
3-[(1,3-dioxoisoindol-2-yl)methyl]-5-(4-methylphenyl)benzoic acid;ethane (PubChem CID 178053111) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methyl]-5-(4-methylphenyl)benzoic acid;ethane.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-5-(4-methylphenyl)benzoic acid;ethane |
|---|---|
| PubChem CID | 178053111 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-5-(4-methylphenyl)benzoic acid;ethane |
| SMILES | CC.Cc1ccc(-c2cc(CN3C(=O)c4ccccc4C3=O)cc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C23H17NO4.C2H6/c1-14-6-8-16(9-7-14)17-10-15(11-18(12-17)23(27)28)13-24-21(25)19-4-2-3-5-20(19)22(24)26;1-2/h2-12H,13H2,1H3,(H,27,28);1-2H3 |
| InChIKey | UGXBOVWWJCRBJJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|