C14H13ClO3 — CID 174615731
3-(hydroxymethyl)-5-phenylbenzoic acid;hydrochloride (PubChem CID 174615731) has the molecular formula C14H13ClO3 and a molecular weight of 264.71 g/mol. Its IUPAC name is 3-(hydroxymethyl)-5-phenylbenzoic acid;hydrochloride.
| Compound Name | 3-(hydroxymethyl)-5-phenylbenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 174615731 |
| Molecular Formula | C14H13ClO3 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 3-(hydroxymethyl)-5-phenylbenzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1cc(CO)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H12O3.ClH/c15-9-10-6-12(8-13(7-10)14(16)17)11-4-2-1-3-5-11;/h1-8,15H,9H2,(H,16,17);1H |
| InChIKey | MUPSEMUVFRJLAL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |