C28H20F6O3 — CID 162182546
3-[4-(trifluoromethyl)phenyl]benzoic acid;[3-[4-(trifluoromethyl)phenyl]phenyl]methanol (PubChem CID 162182546) has the molecular formula C28H20F6O3 and a molecular weight of 518.45 g/mol. Its IUPAC name is 3-[4-(trifluoromethyl)phenyl]benzoic acid;[3-[4-(trifluoromethyl)phenyl]phenyl]methanol.
| Compound Name | 3-[4-(trifluoromethyl)phenyl]benzoic acid;[3-[4-(trifluoromethyl)phenyl]phenyl]methanol |
|---|---|
| PubChem CID | 162182546 |
| Molecular Formula | C28H20F6O3 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | 3-[4-(trifluoromethyl)phenyl]benzoic acid;[3-[4-(trifluoromethyl)phenyl]phenyl]methanol |
| SMILES | O=C(O)c1cccc(-c2ccc(C(F)(F)F)cc2)c1.OCc1cccc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C14H9F3O2.C14H11F3O/c15-14(16,17)12-6-4-9(5-7-12)10-2-1-3-11(8-10)13(18)19;15-14(16,17)13-6-4-11(5-7-13)12-3-1-2-10(8-12)9-18/h1-8H,(H,18,19);1-8,18H,9H2 |
| InChIKey | ZPFOVMUIZVVPPF-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |