C16H13BrF3NO — CID 118222623
2-bromo-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]acetamide (PubChem CID 118222623) has the molecular formula C16H13BrF3NO and a molecular weight of 372.18 g/mol. Its IUPAC name is 2-bromo-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]acetamide.
| Compound Name | 2-bromo-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 118222623 |
| Molecular Formula | C16H13BrF3NO |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 2-bromo-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]acetamide |
| SMILES | O=C(CBr)NCc1cccc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C16H13BrF3NO/c17-9-15(22)21-10-11-2-1-3-13(8-11)12-4-6-14(7-5-12)16(18,19)20/h1-8H,9-10H2,(H,21,22) |
| InChIKey | BYISXCPQIIYZIX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|