C25H22ClF3N2O3S — CID 90384268
2-[2-(4-chlorophenyl)sulfonylethylamino]-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]prop-2-enamide (PubChem CID 90384268) has the molecular formula C25H22ClF3N2O3S and a molecular weight of 522.98 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)sulfonylethylamino]-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]prop-2-enamide.
| Compound Name | 2-[2-(4-chlorophenyl)sulfonylethylamino]-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 90384268 |
| Molecular Formula | C25H22ClF3N2O3S |
| Molecular Weight | 522.98 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 2-[2-(4-chlorophenyl)sulfonylethylamino]-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]prop-2-enamide |
| SMILES | C=C(NCCS(=O)(=O)c1ccc(Cl)cc1)C(=O)NCc1cccc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C25H22ClF3N2O3S/c1-17(30-13-14-35(33,34)23-11-9-22(26)10-12-23)24(32)31-16-18-3-2-4-20(15-18)19-5-7-21(8-6-19)25(27,28)29/h2-12,15,30H,1,13-14,16H2,(H,31,32) |
| InChIKey | FDGDCWQXCPAICH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.98 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|