C25H20F4N2O3S — CID 66832445
(2S)-1-(4-fluorophenyl)sulfonyl-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-2,5-dihydropyrrole-2-carboxamide (PubChem CID 66832445) has the molecular formula C25H20F4N2O3S and a molecular weight of 504.51 g/mol. Its IUPAC name is (2S)-1-(4-fluorophenyl)sulfonyl-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-2,5-dihydropyrrole-2-carboxamide.
| Compound Name | (2S)-1-(4-fluorophenyl)sulfonyl-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-2,5-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 66832445 |
| Molecular Formula | C25H20F4N2O3S |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | (2S)-1-(4-fluorophenyl)sulfonyl-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-2,5-dihydropyrrole-2-carboxamide |
| SMILES | O=C(NCc1cccc(-c2ccc(C(F)(F)F)cc2)c1)[C@@H]1C=CCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H20F4N2O3S/c26-21-10-12-22(13-11-21)35(33,34)31-14-2-5-23(31)24(32)30-16-17-3-1-4-19(15-17)18-6-8-20(9-7-18)25(27,28)29/h1-13,15,23H,14,16H2,(H,30,32)/t23-/m0/s1 |
| InChIKey | RIVDVFVWQRGFFA-QHCPKHFHSA-N |
| XLogP | 4.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|