C12H12FNO4S — CID 122456120
methyl 1-(4-fluorophenyl)sulfonyl-2,5-dihydropyrrole-2-carboxylate (PubChem CID 122456120) has the molecular formula C12H12FNO4S and a molecular weight of 285.30 g/mol. Its IUPAC name is methyl 1-(4-fluorophenyl)sulfonyl-2,5-dihydropyrrole-2-carboxylate.
| Compound Name | methyl 1-(4-fluorophenyl)sulfonyl-2,5-dihydropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 122456120 |
| Molecular Formula | C12H12FNO4S |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | methyl 1-(4-fluorophenyl)sulfonyl-2,5-dihydropyrrole-2-carboxylate |
| SMILES | COC(=O)C1C=CCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H12FNO4S/c1-18-12(15)11-3-2-8-14(11)19(16,17)10-6-4-9(13)5-7-10/h2-7,11H,8H2,1H3 |
| InChIKey | SROOQQNCHJUHHL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|