C12H13F2NO4S — CID 154409043
methyl (3S)-3-fluoro-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 154409043) has the molecular formula C12H13F2NO4S and a molecular weight of 305.30 g/mol. Its IUPAC name is methyl (3S)-3-fluoro-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | methyl (3S)-3-fluoro-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 154409043 |
| Molecular Formula | C12H13F2NO4S |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | methyl (3S)-3-fluoro-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1[C@@H](F)CCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13F2NO4S/c1-19-12(16)11-10(14)6-7-15(11)20(17,18)9-4-2-8(13)3-5-9/h2-5,10-11H,6-7H2,1H3/t10-,11?/m0/s1 |
| InChIKey | ISPMWRIAOORCDS-VUWPPUDQSA-N |
| XLogP | 1.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |