C16H16F5N3O3S — CID 147601742
(2R,3R)-3-fluoro-1-(4-fluorophenyl)sulfonyl-N-[(Z)-[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]pyrrolidine-2-carboxamide (PubChem CID 147601742) has the molecular formula C16H16F5N3O3S and a molecular weight of 425.38 g/mol. Its IUPAC name is (2R,3R)-3-fluoro-1-(4-fluorophenyl)sulfonyl-N-[(Z)-[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]pyrrolidine-2-carboxamide.
| Compound Name | (2R,3R)-3-fluoro-1-(4-fluorophenyl)sulfonyl-N-[(Z)-[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 147601742 |
| Molecular Formula | C16H16F5N3O3S |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | (2R,3R)-3-fluoro-1-(4-fluorophenyl)sulfonyl-N-[(Z)-[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]pyrrolidine-2-carboxamide |
| SMILES | C/C=C\C(=N\NC(=O)[C@@H]1[C@H](F)CCN1S(=O)(=O)c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H16F5N3O3S/c1-2-3-13(16(19,20)21)22-23-15(25)14-12(18)8-9-24(14)28(26,27)11-6-4-10(17)5-7-11/h2-7,12,14H,8-9H2,1H3,(H,23,25)/b3-2-,22-13-/t12-,14+/m1/s1 |
| InChIKey | GAGZUKFBQCGAKD-ALRQELESSA-N |
| XLogP | 2.54 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|