C19H25N3O4S — CID 16672296
(2R)-1-(4-acetamidophenyl)sulfonyl-N-cyclohexyl-2,5-dihydropyrrole-2-carboxamide (PubChem CID 16672296) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is (2R)-1-(4-acetamidophenyl)sulfonyl-N-cyclohexyl-2,5-dihydropyrrole-2-carboxamide.
| Compound Name | (2R)-1-(4-acetamidophenyl)sulfonyl-N-cyclohexyl-2,5-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 16672296 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (2R)-1-(4-acetamidophenyl)sulfonyl-N-cyclohexyl-2,5-dihydropyrrole-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CC=C[C@@H]2C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H25N3O4S/c1-14(23)20-16-9-11-17(12-10-16)27(25,26)22-13-5-8-18(22)19(24)21-15-6-3-2-4-7-15/h5,8-12,15,18H,2-4,6-7,13H2,1H3,(H,20,23)(H,21,24)/t18-/m1/s1 |
| InChIKey | NXJAUVWNVBGWRP-GOSISDBHSA-N |
| XLogP | 2.02 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|