C17H21FN2O3S — CID 46952323
(2S)-N-cyclohexyl-1-(2-fluorophenyl)sulfonyl-2,5-dihydropyrrole-2-carboxamide (PubChem CID 46952323) has the molecular formula C17H21FN2O3S and a molecular weight of 352.43 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-1-(2-fluorophenyl)sulfonyl-2,5-dihydropyrrole-2-carboxamide.
| Compound Name | (2S)-N-cyclohexyl-1-(2-fluorophenyl)sulfonyl-2,5-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 46952323 |
| Molecular Formula | C17H21FN2O3S |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (2S)-N-cyclohexyl-1-(2-fluorophenyl)sulfonyl-2,5-dihydropyrrole-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)[C@@H]1C=CCN1S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C17H21FN2O3S/c18-14-9-4-5-11-16(14)24(22,23)20-12-6-10-15(20)17(21)19-13-7-2-1-3-8-13/h4-6,9-11,13,15H,1-3,7-8,12H2,(H,19,21)/t15-/m0/s1 |
| InChIKey | BHQJIRDCBZCCEK-HNNXBMFYSA-N |
| XLogP | 2.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|