C15H20FNO3S — CID 94151255
(2S)-N-cyclohexyl-2-(2-fluorophenyl)sulfonylpropanamide (PubChem CID 94151255) has the molecular formula C15H20FNO3S and a molecular weight of 313.39 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-(2-fluorophenyl)sulfonylpropanamide.
| Compound Name | (2S)-N-cyclohexyl-2-(2-fluorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 94151255 |
| Molecular Formula | C15H20FNO3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (2S)-N-cyclohexyl-2-(2-fluorophenyl)sulfonylpropanamide |
| SMILES | C[C@@H](C(=O)NC1CCCCC1)S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C15H20FNO3S/c1-11(15(18)17-12-7-3-2-4-8-12)21(19,20)14-10-6-5-9-13(14)16/h5-6,9-12H,2-4,7-8H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | VMMLFXPVBIOVKK-NSHDSACASA-N |
| XLogP | 2.44 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |