C16H22FNO3S — CID 51946941
(2S)-N-cyclohexyl-2-[(3-fluorophenyl)methylsulfonyl]propanamide (PubChem CID 51946941) has the molecular formula C16H22FNO3S and a molecular weight of 327.42 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[(3-fluorophenyl)methylsulfonyl]propanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[(3-fluorophenyl)methylsulfonyl]propanamide |
|---|---|
| PubChem CID | 51946941 |
| Molecular Formula | C16H22FNO3S |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[(3-fluorophenyl)methylsulfonyl]propanamide |
| SMILES | C[C@@H](C(=O)NC1CCCCC1)S(=O)(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H22FNO3S/c1-12(16(19)18-15-8-3-2-4-9-15)22(20,21)11-13-6-5-7-14(17)10-13/h5-7,10,12,15H,2-4,8-9,11H2,1H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | FBKZRDXPQMDXKP-LBPRGKRZSA-N |
| XLogP | 2.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |